About 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol
1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol (PubChem CID 52943938) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol |
| PubChem CID | 52943938 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C(C)(O)c2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C17H17NOS/c1-11-8-9-13(12(2)10-11)17(3,19)16-18-14-6-4-5-7-15(14)20-16/h4-10,19H,1-3H3 |
| InChIKey | IGSZVEPQZANNAB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol?
The IUPAC name of 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol (CID 52943938) is 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol.
What is the SMILES notation for 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol?
The canonical SMILES for 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol is Cc1ccc(C(C)(O)c2nc3ccccc3s2)c(C)c1.
What is the InChIKey of 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol?
The InChIKey is IGSZVEPQZANNAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c1-11-8-9-13(12(2)10-11)17(3,19)16-18-14-6-4-5-7-15(14)20-16/h4-10,19H,1-3H3.
What are the key properties of 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol?
1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol has a molecular weight of 283.40 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-yl)-1-(2,4-dimethylphenyl)ethanol is sourced from PubChem (CID 52943938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).