C20H22N4O3 — CID 52943949
(9R)-9-[(R)-anilino(phenyl)methyl]-1,4,7-triazecane-2,5,8-trione (PubChem CID 52943949) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (9R)-9-[(R)-anilino(phenyl)methyl]-1,4,7-triazecane-2,5,8-trione.
| Compound Name | (9R)-9-[(R)-anilino(phenyl)methyl]-1,4,7-triazecane-2,5,8-trione |
|---|---|
| PubChem CID | 52943949 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (9R)-9-[(R)-anilino(phenyl)methyl]-1,4,7-triazecane-2,5,8-trione |
| SMILES | O=C1CNC(=O)CNC(=O)[C@@H]([C@@H](Nc2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C20H22N4O3/c25-17-12-22-18(26)13-23-20(27)16(11-21-17)19(14-7-3-1-4-8-14)24-15-9-5-2-6-10-15/h1-10,16,19,24H,11-13H2,(H,21,25)(H,22,26)(H,23,27)/t16-,19+/m1/s1 |
| InChIKey | XLXKEWHHCHJFKI-APWZRJJASA-N |
| XLogP | 0.82 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |