C26H25F7N2O2 — CID 52943994
(1S,2R,5aS,7R,8aR,8bS)-7-amino-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2,3,5a,6,7,8,8a,8b-octahydro-1H-cyclopenta[a]pyrrolizin-5-one (PubChem CID 52943994) has the molecular formula C26H25F7N2O2 and a molecular weight of 530.48 g/mol. Its IUPAC name is (1S,2R,5aS,7R,8aR,8bS)-7-amino-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2,3,5a,6,7,8,8a,8b-octahydro-1H-cyclopenta[a]pyrrolizin-5-one.
| Compound Name | (1S,2R,5aS,7R,8aR,8bS)-7-amino-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2,3,5a,6,7,8,8a,8b-octahydro-1H-cyclopenta[a]pyrrolizin-5-one |
|---|---|
| PubChem CID | 52943994 |
| Molecular Formula | C26H25F7N2O2 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (1S,2R,5aS,7R,8aR,8bS)-7-amino-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-2,3,5a,6,7,8,8a,8b-octahydro-1H-cyclopenta[a]pyrrolizin-5-one |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)[C@H]3C[C@H](N)C[C@H]3[C@H]2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H25F7N2O2/c1-12(14-6-15(25(28,29)30)8-16(7-14)26(31,32)33)37-21-11-35-23(19-9-18(34)10-20(19)24(35)36)22(21)13-2-4-17(27)5-3-13/h2-8,12,18-23H,9-11,34H2,1H3/t12-,18-,19-,20+,21+,22-,23+/m1/s1 |
| InChIKey | CMHQSZGZHCBTQY-RSKZVPLKSA-N |
| XLogP | 5.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |