C23H21FN4O — CID 52944068
1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(5-fluoro-2-pyridinyl)pyridin-2-one (PubChem CID 52944068) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(5-fluoro-2-pyridinyl)pyridin-2-one.
| Compound Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(5-fluoro-2-pyridinyl)pyridin-2-one |
|---|---|
| PubChem CID | 52944068 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-(2,9-dimethyl-3,4-dihydro-1H-pyrido[3,4-b]indol-7-yl)-4-(5-fluoro-2-pyridinyl)pyridin-2-one |
| SMILES | CN1CCc2c(n(C)c3cc(-n4ccc(-c5ccc(F)cn5)cc4=O)ccc23)C1 |
| InChI | InChI=1S/C23H21FN4O/c1-26-9-8-19-18-5-4-17(12-21(18)27(2)22(19)14-26)28-10-7-15(11-23(28)29)20-6-3-16(24)13-25-20/h3-7,10-13H,8-9,14H2,1-2H3 |
| InChIKey | HCKAAUAUOFIPMF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|