C16H14F6N4O3S — CID 52944118
1,1,1,3,3,3-hexafluoro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 52944118) has the molecular formula C16H14F6N4O3S and a molecular weight of 456.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 52944118 |
| Molecular Formula | C16H14F6N4O3S |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(c3ncc(C(O)(C(F)(F)F)C(F)(F)F)s3)CC2)cc1 |
| InChI | InChI=1S/C16H14F6N4O3S/c17-15(18,19)14(27,16(20,21)22)12-9-23-13(30-12)25-7-5-24(6-8-25)10-1-3-11(4-2-10)26(28)29/h1-4,9,27H,5-8H2 |
| InChIKey | LREVIJYCPJFWRX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|