C26H39ClN4O4 — CID 52944138
propyl 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride (PubChem CID 52944138) has the molecular formula C26H39ClN4O4 and a molecular weight of 507.08 g/mol. Its IUPAC name is propyl 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride.
| Compound Name | propyl 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 52944138 |
| Molecular Formula | C26H39ClN4O4 |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | propyl 2-[4-[4-(1,4-dioxo-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazin-2-yl)butyl]piperazin-1-yl]benzoate;hydrochloride |
| SMILES | CCCOC(=O)c1ccccc1N1CCN(CCCCN2CC(=O)N3CCCCC3C2=O)CC1.Cl |
| InChI | InChI=1S/C26H38N4O4.ClH/c1-2-19-34-26(33)21-9-3-4-10-22(21)28-17-15-27(16-18-28)12-7-8-13-29-20-24(31)30-14-6-5-11-23(30)25(29)32;/h3-4,9-10,23H,2,5-8,11-20H2,1H3;1H |
| InChIKey | OVRAFHLZHSREQU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|