About CID 52944151
CID 52944151 (PubChem CID 52944151) has the molecular formula C11H22NO2
and a molecular weight of 200.30 g/mol.
Molecular Properties
| Compound Name | CID 52944151 |
| PubChem CID | 52944151 |
| Molecular Formula | C11H22NO2 |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.17 |
| IUPAC Name | — |
| SMILES | CCOC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C11H22NO2/c1-6-14-9-7-10(2,3)12(13)11(4,5)8-9/h9H,6-8H2,1-5H3 |
| InChIKey | GQCYGRRMOOBNGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 52944151 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 52944151?
The IUPAC name of CID 52944151 (CID 52944151) is not available.
What is the SMILES notation for CID 52944151?
The canonical SMILES for CID 52944151 is CCOC1CC(C)(C)N([O])C(C)(C)C1.
What is the InChIKey of CID 52944151?
The InChIKey is GQCYGRRMOOBNGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22NO2/c1-6-14-9-7-10(2,3)12(13)11(4,5)8-9/h9H,6-8H2,1-5H3.
What are the key properties of CID 52944151?
CID 52944151 has a molecular weight of 200.30 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 52944151 is sourced from PubChem (CID 52944151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).