C39H40ClNO4 — CID 52944222
17-methoxy-16-[(4-propan-2-ylphenyl)methoxy]-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 52944222) has the molecular formula C39H40ClNO4 and a molecular weight of 622.21 g/mol. Its IUPAC name is 17-methoxy-16-[(4-propan-2-ylphenyl)methoxy]-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 17-methoxy-16-[(4-propan-2-ylphenyl)methoxy]-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 52944222 |
| Molecular Formula | C39H40ClNO4 |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.26 |
| IUPAC Name | 17-methoxy-16-[(4-propan-2-ylphenyl)methoxy]-21-[(4-propan-2-ylphenyl)methyl]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | COc1ccc2c(Cc3ccc(C(C)C)cc3)c3[n+](cc2c1OCc1ccc(C(C)C)cc1)CCc1cc2c(cc1-3)OCO2.[Cl-] |
| InChI | InChI=1S/C39H40NO4.ClH/c1-24(2)28-10-6-26(7-11-28)18-33-31-14-15-35(41-5)39(42-22-27-8-12-29(13-9-27)25(3)4)34(31)21-40-17-16-30-19-36-37(44-23-43-36)20-32(30)38(33)40;/h6-15,19-21,24-25H,16-18,22-23H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | XLKCYELBGPBROE-UHFFFAOYSA-M |
| XLogP | 5.51 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|