About ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate
ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate (PubChem CID 52944422) has the molecular formula C37H38N2O4
and a molecular weight of 574.72 g/mol. Its IUPAC name is ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate |
| PubChem CID | 52944422 |
| Molecular Formula | C37H38N2O4 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C(c3c(C)n(C)c4ccccc34)c3c(C)n(C)c4ccccc34)cc(C(C)CC)c2oc1=O |
| InChI | InChI=1S/C37H38N2O4/c1-8-21(3)28-19-24(18-25-20-29(36(40)42-9-2)37(41)43-35(25)28)34(32-22(4)38(6)30-16-12-10-14-26(30)32)33-23(5)39(7)31-17-13-11-15-27(31)33/h10-21,34H,8-9H2,1-7H3 |
| InChIKey | FQNISLFYNHQCJY-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 66.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate?
The IUPAC name of ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate (CID 52944422) is ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate.
What is the SMILES notation for ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate?
The canonical SMILES for ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate is CCOC(=O)c1cc2cc(C(c3c(C)n(C)c4ccccc34)c3c(C)n(C)c4ccccc34)cc(C(C)CC)c2oc1=O.
What is the InChIKey of ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate?
The InChIKey is FQNISLFYNHQCJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H38N2O4/c1-8-21(3)28-19-24(18-25-20-29(36(40)42-9-2)37(41)43-35(25)28)34(32-22(4)38(6)30-16-12-10-14-26(30)32)33-23(5)39(7)31-17-13-11-15-27(31)33/h10-21,34H,8-9H2,1-7H3.
What are the key properties of ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate?
ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate has a molecular weight of 574.72 g/mol, XLogP of 8.26, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-8-butan-2-yl-2-oxochromene-3-carboxylate is sourced from PubChem (CID 52944422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).