C27H20N6S — CID 52944724
10-benzylsulfanyl-7-methyl-4-phenyl-13-pyridin-4-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 52944724) has the molecular formula C27H20N6S and a molecular weight of 460.57 g/mol. Its IUPAC name is 10-benzylsulfanyl-7-methyl-4-phenyl-13-pyridin-4-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 10-benzylsulfanyl-7-methyl-4-phenyl-13-pyridin-4-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 52944724 |
| Molecular Formula | C27H20N6S |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 10-benzylsulfanyl-7-methyl-4-phenyl-13-pyridin-4-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | Cc1nc2c(SCc3ccccc3)nnc(-c3ccncc3)c2c2cc(-c3ccccc3)nn12 |
| InChI | InChI=1S/C27H20N6S/c1-18-29-26-24(23-16-22(32-33(18)23)20-10-6-3-7-11-20)25(21-12-14-28-15-13-21)30-31-27(26)34-17-19-8-4-2-5-9-19/h2-16H,17H2,1H3 |
| InChIKey | RATVYJNEMKIGOI-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 68.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |