About tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate
tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate (PubChem CID 52944745) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate |
| PubChem CID | 52944745 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2c(c3c1[nH]c1ccccc13)C(=O)NC2=O |
| InChI | InChI=1S/C19H16N2O4/c1-19(2,3)25-18(24)11-8-10-14(17(23)21-16(10)22)13-9-6-4-5-7-12(9)20-15(11)13/h4-8,20H,1-3H3,(H,21,22,23) |
| InChIKey | VLDZAEPAPDAACU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate?
The IUPAC name of tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate (CID 52944745) is tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate.
What is the SMILES notation for tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate?
The canonical SMILES for tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate is CC(C)(C)OC(=O)c1cc2c(c3c1[nH]c1ccccc13)C(=O)NC2=O.
What is the InChIKey of tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate?
The InChIKey is VLDZAEPAPDAACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-19(2,3)25-18(24)11-8-10-14(17(23)21-16(10)22)13-9-6-4-5-7-12(9)20-15(11)13/h4-8,20H,1-3H3,(H,21,22,23).
What are the key properties of tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate?
tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate has a molecular weight of 336.35 g/mol, XLogP of 3.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,3-dioxo-6H-pyrrolo[3,4-c]carbazole-5-carboxylate is sourced from PubChem (CID 52944745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).