C17H29N3S — CID 52944796
(1R,2R,4S,9S,17S)-4-(ethylamino)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-6-thione (PubChem CID 52944796) has the molecular formula C17H29N3S and a molecular weight of 307.51 g/mol. Its IUPAC name is (1R,2R,4S,9S,17S)-4-(ethylamino)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-6-thione.
| Compound Name | (1R,2R,4S,9S,17S)-4-(ethylamino)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-6-thione |
|---|---|
| PubChem CID | 52944796 |
| Molecular Formula | C17H29N3S |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (1R,2R,4S,9S,17S)-4-(ethylamino)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecane-6-thione |
| SMILES | CCN[C@@H]1CC(=S)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2C1 |
| InChI | InChI=1S/C17H29N3S/c1-2-18-13-9-15-14-6-4-8-19-7-3-5-12(17(14)19)11-20(15)16(21)10-13/h12-15,17-18H,2-11H2,1H3/t12-,13-,14+,15+,17-/m0/s1 |
| InChIKey | QHTCNYVLFOMDAG-XGYYKPKNSA-N |
| XLogP | 2.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|