C27H29N5O4 — CID 52944849
(5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-[(1-methylpiperidin-4-yl)methyl]-3-pyridinyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 52944849) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-[(1-methylpiperidin-4-yl)methyl]-3-pyridinyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-[(1-methylpiperidin-4-yl)methyl]-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 52944849 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (5R)-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[6-[(1-methylpiperidin-4-yl)methyl]-3-pyridinyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(CC4CCN(C)CC4)nc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H29N5O4/c1-31-11-8-18(9-12-31)13-21-5-3-19(15-28-21)7-10-27(25(34)29-26(35)30-27)17-32-16-20-4-6-22(36-2)14-23(20)24(32)33/h3-6,14-15,18H,8-9,11-13,16-17H2,1-2H3,(H2,29,30,34,35)/t27-/m1/s1 |
| InChIKey | ATUIUMZYBUFUGD-HHHXNRCGSA-N |
| XLogP | 1.56 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|