C24H22FN3O — CID 52944997
1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluorophenyl)pyridin-2-one (PubChem CID 52944997) has the molecular formula C24H22FN3O and a molecular weight of 387.46 g/mol. Its IUPAC name is 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluorophenyl)pyridin-2-one.
| Compound Name | 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluorophenyl)pyridin-2-one |
|---|---|
| PubChem CID | 52944997 |
| Molecular Formula | C24H22FN3O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-(2,5-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-7-yl)-4-(4-fluorophenyl)pyridin-2-one |
| SMILES | CN1CCc2c(c3ccc(-n4ccc(-c5ccc(F)cc5)cc4=O)cc3n2C)C1 |
| InChI | InChI=1S/C24H22FN3O/c1-26-11-10-22-21(15-26)20-8-7-19(14-23(20)27(22)2)28-12-9-17(13-24(28)29)16-3-5-18(25)6-4-16/h3-9,12-14H,10-11,15H2,1-2H3 |
| InChIKey | PLNWLTBZTOTUTI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|