C25H33F2N3O3 — CID 52945011
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[1-[5-(2,2-dimethylpropyl)-1-oxidopyridin-1-ium-3-yl]cyclopropyl]amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 52945011) has the molecular formula C25H33F2N3O3 and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[1-[5-(2,2-dimethylpropyl)-1-oxidopyridin-1-ium-3-yl]cyclopropyl]amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[1-[5-(2,2-dimethylpropyl)-1-oxidopyridin-1-ium-3-yl]cyclopropyl]amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 52945011 |
| Molecular Formula | C25H33F2N3O3 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[[1-[5-(2,2-dimethylpropyl)-1-oxidopyridin-1-ium-3-yl]cyclopropyl]amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1cc(F)cc(F)c1)[C@H](O)CNC1(c2cc(CC(C)(C)C)c[n+]([O-])c2)CC1 |
| InChI | InChI=1S/C25H33F2N3O3/c1-16(31)29-22(10-17-8-20(26)11-21(27)9-17)23(32)13-28-25(5-6-25)19-7-18(12-24(2,3)4)14-30(33)15-19/h7-9,11,14-15,22-23,28,32H,5-6,10,12-13H2,1-4H3,(H,29,31)/t22-,23+/m0/s1 |
| InChIKey | KZOWDSWZTVEAML-XZOQPEGZSA-N |
| XLogP | 2.87 |
| TPSA | 88.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|