About sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole
sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole (PubChem CID 52945043) has the molecular formula C8H9N2NaO3S
and a molecular weight of 236.23 g/mol. Its IUPAC name is sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole.
Molecular Properties
| Compound Name | sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole |
| PubChem CID | 52945043 |
| Molecular Formula | C8H9N2NaO3S |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole |
| SMILES | NS([O-])(O)Cc1noc2ccccc12.[Na+] |
| InChI | InChI=1S/C8H10N2O3S.Na/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7;/h1-4,11-12H,5,9H2;/q;+1/p-1 |
| InChIKey | DZCBKRDFZWJGAR-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole?
The IUPAC name of sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole (CID 52945043) is sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole.
What is the SMILES notation for sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole?
The canonical SMILES for sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole is NS([O-])(O)Cc1noc2ccccc12.[Na+].
What is the InChIKey of sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole?
The InChIKey is DZCBKRDFZWJGAR-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N2O3S.Na/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7;/h1-4,11-12H,5,9H2;/q;+1/p-1.
What are the key properties of sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole?
sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole has a molecular weight of 236.23 g/mol, XLogP of -1.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-[(amino-hydroxy-oxido-λ4-sulfanyl)methyl]-1,2-benzoxazole is sourced from PubChem (CID 52945043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).