About 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride
1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride (PubChem CID 52945146) has the molecular formula C18H22ClN3O
and a molecular weight of 331.85 g/mol. Its IUPAC name is 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride.
Molecular Properties
| Compound Name | 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride |
| PubChem CID | 52945146 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CCN2c1cncc(OC[C@@H]2CCCN2)c1 |
| InChI | InChI=1S/C18H21N3O.ClH/c1-2-6-18-14(4-1)7-9-21(18)16-10-17(12-19-11-16)22-13-15-5-3-8-20-15;/h1-2,4,6,10-12,15,20H,3,5,7-9,13H2;1H/t15-;/m0./s1 |
| InChIKey | VMFZGYJSWOVBAK-RSAXXLAASA-N |
| XLogP | 3.33 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride?
The IUPAC name of 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride (CID 52945146) is 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride.
What is the SMILES notation for 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride?
The canonical SMILES for 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride is Cl.c1ccc2c(c1)CCN2c1cncc(OC[C@@H]2CCCN2)c1.
What is the InChIKey of 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride?
The InChIKey is VMFZGYJSWOVBAK-RSAXXLAASA-N. The full InChI is InChI=1S/C18H21N3O.ClH/c1-2-6-18-14(4-1)7-9-21(18)16-10-17(12-19-11-16)22-13-15-5-3-8-20-15;/h1-2,4,6,10-12,15,20H,3,5,7-9,13H2;1H/t15-;/m0./s1.
What are the key properties of 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride?
1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride has a molecular weight of 331.85 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[[(2S)-pyrrolidin-2-yl]methoxy]-3-pyridinyl]-2,3-dihydroindole;hydrochloride is sourced from PubChem (CID 52945146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).