C25H40N2O8 — CID 52945157
trans-(3R,5R)-1,3,4,5-tetrahydroxy-N-[3-hydroxy-1-(4-octoxyanilino)-1-oxobutan-2-yl]cyclohexane-1-carboxamide (PubChem CID 52945157) has the molecular formula C25H40N2O8 and a molecular weight of 496.60 g/mol. Its IUPAC name is trans-(3R,5R)-1,3,4,5-tetrahydroxy-N-[3-hydroxy-1-(4-octoxyanilino)-1-oxobutan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | trans-(3R,5R)-1,3,4,5-tetrahydroxy-N-[3-hydroxy-1-(4-octoxyanilino)-1-oxobutan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 52945157 |
| Molecular Formula | C25H40N2O8 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | trans-(3R,5R)-1,3,4,5-tetrahydroxy-N-[3-hydroxy-1-(4-octoxyanilino)-1-oxobutan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCCCCCOc1ccc(NC(=O)C(NC(=O)C2(O)C[C@@H](O)C(O)[C@H](O)C2)C(C)O)cc1 |
| InChI | InChI=1S/C25H40N2O8/c1-3-4-5-6-7-8-13-35-18-11-9-17(10-12-18)26-23(32)21(16(2)28)27-24(33)25(34)14-19(29)22(31)20(30)15-25/h9-12,16,19-22,28-31,34H,3-8,13-15H2,1-2H3,(H,26,32)(H,27,33)/t16?,19-,20-,21?,22?,25?/m1/s1 |
| InChIKey | VFKYWENFHUNGIR-OCQLHNPPSA-N |
| XLogP | 0.84 |
| TPSA | 168.58 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|