About (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol
(2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol (PubChem CID 52945159) has the molecular formula C20H23Cl2NO
and a molecular weight of 364.32 g/mol. Its IUPAC name is (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol.
Molecular Properties
| Compound Name | (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol |
| PubChem CID | 52945159 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol |
| SMILES | OC[C@H](c1ccc(Cl)c(Cl)c1)[C@H]1CCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H23Cl2NO/c21-18-10-9-16(12-19(18)22)17(14-24)20-8-4-5-11-23(20)13-15-6-2-1-3-7-15/h1-3,6-7,9-10,12,17,20,24H,4-5,8,11,13-14H2/t17-,20-/m1/s1 |
| InChIKey | NRJOAYKSGZHTCR-YLJYHZDGSA-N |
| XLogP | 5.12 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol?
The IUPAC name of (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol (CID 52945159) is (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol.
What is the SMILES notation for (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol?
The canonical SMILES for (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol is OC[C@H](c1ccc(Cl)c(Cl)c1)[C@H]1CCCCN1Cc1ccccc1.
What is the InChIKey of (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol?
The InChIKey is NRJOAYKSGZHTCR-YLJYHZDGSA-N. The full InChI is InChI=1S/C20H23Cl2NO/c21-18-10-9-16(12-19(18)22)17(14-24)20-8-4-5-11-23(20)13-15-6-2-1-3-7-15/h1-3,6-7,9-10,12,17,20,24H,4-5,8,11,13-14H2/t17-,20-/m1/s1.
What are the key properties of (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol?
(2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol has a molecular weight of 364.32 g/mol, XLogP of 5.12, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2R)-1-benzylpiperidin-2-yl]-2-(3,4-dichlorophenyl)ethanol is sourced from PubChem (CID 52945159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).