C20H6Cl2I4O5 — CID 52945185
4,5-dichloro-2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 52945185) has the molecular formula C20H6Cl2I4O5 and a molecular weight of 904.78 g/mol. Its IUPAC name is 4,5-dichloro-2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 4,5-dichloro-2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 52945185 |
| Molecular Formula | C20H6Cl2I4O5 |
| Molecular Weight | 904.78 g/mol |
| Exact Mass | 903.58 |
| IUPAC Name | 4,5-dichloro-2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(Cl)cc1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c(O)c(I)cc12 |
| InChI | InChI=1S/C20H6Cl2I4O5/c21-9-1-5(6(20(29)30)2-10(9)22)13-7-3-11(23)16(27)14(25)18(7)31-19-8(13)4-12(24)17(28)15(19)26/h1-4,27H,(H,29,30) |
| InChIKey | DAKDSCLJBNGAHL-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.78 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|