C18H9N7O2S — CID 5294525
4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-5-nitrobenzene-1,2-dicarbonitrile (PubChem CID 5294525) has the molecular formula C18H9N7O2S and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-5-nitrobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-5-nitrobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 5294525 |
| Molecular Formula | C18H9N7O2S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 4-[(5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-5-nitrobenzene-1,2-dicarbonitrile |
| SMILES | Cn1c2ccccc2c2nnc(Sc3cc(C#N)c(C#N)cc3[N+](=O)[O-])nc21 |
| InChI | InChI=1S/C18H9N7O2S/c1-24-13-5-3-2-4-12(13)16-17(24)21-18(23-22-16)28-15-7-11(9-20)10(8-19)6-14(15)25(26)27/h2-7H,1H3 |
| InChIKey | MNTFGAJVSSGHKC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|