C27H33NO3 — CID 52945254
(1R,4aS,9E,10aR)-1,4a-dimethyl-9-phenylmethoxyimino-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 52945254) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-1,4a-dimethyl-9-phenylmethoxyimino-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-1,4a-dimethyl-9-phenylmethoxyimino-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 52945254 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (1R,4aS,9E,10aR)-1,4a-dimethyl-9-phenylmethoxyimino-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(c1)/C(=N/OCc1ccccc1)C[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C27H33NO3/c1-18(2)20-11-12-22-21(15-20)23(28-31-17-19-9-6-5-7-10-19)16-24-26(22,3)13-8-14-27(24,4)25(29)30/h5-7,9-12,15,18,24H,8,13-14,16-17H2,1-4H3,(H,29,30)/b28-23+/t24-,26-,27-/m1/s1 |
| InChIKey | MDEWDSMNUSWUQG-FOOCURJHSA-N |
| XLogP | 6.28 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|