About (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone
(9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone (PubChem CID 52945255) has the molecular formula C21H26N4O
and a molecular weight of 350.47 g/mol. Its IUPAC name is (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone.
Molecular Properties
| Compound Name | (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone |
| PubChem CID | 52945255 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1CCC2(CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C21H26N4O/c26-20(19-22-11-4-12-23-19)25-15-9-21(10-16-25)7-13-24(14-8-21)17-18-5-2-1-3-6-18/h1-6,11-12H,7-10,13-17H2 |
| InChIKey | YIWYYFDCFJXRTE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone?
The IUPAC name of (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone (CID 52945255) is (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone.
What is the SMILES notation for (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone?
The canonical SMILES for (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone is O=C(c1ncccn1)N1CCC2(CCN(Cc3ccccc3)CC2)CC1.
What is the InChIKey of (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone?
The InChIKey is YIWYYFDCFJXRTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O/c26-20(19-22-11-4-12-23-19)25-15-9-21(10-16-25)7-13-24(14-8-21)17-18-5-2-1-3-6-18/h1-6,11-12H,7-10,13-17H2.
What are the key properties of (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone?
(9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone has a molecular weight of 350.47 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (9-benzyl-3,9-diazaspiro[5.5]undecan-3-yl)-pyrimidin-2-ylmethanone is sourced from PubChem (CID 52945255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).