About (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone
(9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone (PubChem CID 52945272) has the molecular formula C22H29N3O2S
and a molecular weight of 399.56 g/mol. Its IUPAC name is (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 52945272 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone |
| SMILES | CC(C)c1nc(C(=O)N2CCOC3(CCN(Cc4ccccc4)CC3)C2)cs1 |
| InChI | InChI=1S/C22H29N3O2S/c1-17(2)20-23-19(15-28-20)21(26)25-12-13-27-22(16-25)8-10-24(11-9-22)14-18-6-4-3-5-7-18/h3-7,15,17H,8-14,16H2,1-2H3 |
| InChIKey | MGWLEIOWCHHXGB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The IUPAC name of (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone (CID 52945272) is (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone is CC(C)c1nc(C(=O)N2CCOC3(CCN(Cc4ccccc4)CC3)C2)cs1.
What is the InChIKey of (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
The InChIKey is MGWLEIOWCHHXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3O2S/c1-17(2)20-23-19(15-28-20)21(26)25-12-13-27-22(16-25)8-10-24(11-9-22)14-18-6-4-3-5-7-18/h3-7,15,17H,8-14,16H2,1-2H3.
What are the key properties of (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone?
(9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone has a molecular weight of 399.56 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (9-benzyl-1-oxa-4,9-diazaspiro[5.5]undecan-4-yl)-(2-propan-2-yl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 52945272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).