C21H16F2N4O2S — CID 52945323
1-cyclopropyl-6,7-difluoro-8-methoxy-3-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)quinolin-4-one (PubChem CID 52945323) has the molecular formula C21H16F2N4O2S and a molecular weight of 426.45 g/mol. Its IUPAC name is 1-cyclopropyl-6,7-difluoro-8-methoxy-3-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)quinolin-4-one.
| Compound Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-3-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)quinolin-4-one |
|---|---|
| PubChem CID | 52945323 |
| Molecular Formula | C21H16F2N4O2S |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-cyclopropyl-6,7-difluoro-8-methoxy-3-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)quinolin-4-one |
| SMILES | COc1c(F)c(F)cc2c(=O)c(-c3n[nH]c(=S)n3-c3ccccc3)cn(C3CC3)c12 |
| InChI | InChI=1S/C21H16F2N4O2S/c1-29-19-16(23)15(22)9-13-17(19)26(11-7-8-11)10-14(18(13)28)20-24-25-21(30)27(20)12-5-3-2-4-6-12/h2-6,9-11H,7-8H2,1H3,(H,25,30) |
| InChIKey | QLNGUSGJKCSTMY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|