C25H34N4O10 — CID 52945508
(2R)-2-[[(2S)-2-[[(2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoyl]amino]propanoyl]amino]-5-anilino-5-oxopentanoic acid (PubChem CID 52945508) has the molecular formula C25H34N4O10 and a molecular weight of 550.57 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-[[(2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoyl]amino]propanoyl]amino]-5-anilino-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[(2S)-2-[[(2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoyl]amino]propanoyl]amino]-5-anilino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 52945508 |
| Molecular Formula | C25H34N4O10 |
| Molecular Weight | 550.57 g/mol |
| Exact Mass | 550.23 |
| IUPAC Name | (2R)-2-[[(2S)-2-[[(2R)-2-[[(1R,2S,3S,4R,5R)-4-acetamido-2-hydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]oxy]propanoyl]amino]propanoyl]amino]-5-anilino-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@H]1[C@@H]2OC[C@@H](O2)[C@@H](O)[C@H]1O[C@H](C)C(=O)N[C@@H](C)C(=O)N[C@H](CCC(=O)Nc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H34N4O10/c1-12(22(33)29-16(24(35)36)9-10-18(31)28-15-7-5-4-6-8-15)26-23(34)13(2)38-21-19(27-14(3)30)25-37-11-17(39-25)20(21)32/h4-8,12-13,16-17,19-21,25,32H,9-11H2,1-3H3,(H,26,34)(H,27,30)(H,28,31)(H,29,33)(H,35,36)/t12-,13+,16+,17+,19+,20+,21-,25+/m0/s1 |
| InChIKey | RVQGSPZFUCSXPW-YYSDZESTSA-N |
| XLogP | -1.13 |
| TPSA | 201.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.57 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |