About N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide
N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide (PubChem CID 52945565) has the molecular formula C22H30N2O2S
and a molecular weight of 386.56 g/mol. Its IUPAC name is N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide |
| PubChem CID | 52945565 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide |
| SMILES | CCN1CC[C@@H](c2ccc(-c3ccccc3)cc2)[C@H](NS(=O)(=O)C(C)C)C1 |
| InChI | InChI=1S/C22H30N2O2S/c1-4-24-15-14-21(22(16-24)23-27(25,26)17(2)3)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h5-13,17,21-23H,4,14-16H2,1-3H3/t21-,22+/m0/s1 |
| InChIKey | KGCDTOVRNIRCDU-FCHUYYIVSA-N |
| XLogP | 3.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide?
The IUPAC name of N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide (CID 52945565) is N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide.
What is the SMILES notation for N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide?
The canonical SMILES for N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide is CCN1CC[C@@H](c2ccc(-c3ccccc3)cc2)[C@H](NS(=O)(=O)C(C)C)C1.
What is the InChIKey of N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide?
The InChIKey is KGCDTOVRNIRCDU-FCHUYYIVSA-N. The full InChI is InChI=1S/C22H30N2O2S/c1-4-24-15-14-21(22(16-24)23-27(25,26)17(2)3)20-12-10-19(11-13-20)18-8-6-5-7-9-18/h5-13,17,21-23H,4,14-16H2,1-3H3/t21-,22+/m0/s1.
What are the key properties of N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide?
N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide has a molecular weight of 386.56 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-1-ethyl-4-(4-phenylphenyl)piperidin-3-yl]propane-2-sulfonamide is sourced from PubChem (CID 52945565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).