C15H24O2 — CID 52945608
(1R,2S,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-2-ol (PubChem CID 52945608) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (1R,2S,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-2-ol.
| Compound Name | (1R,2S,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-2-ol |
|---|---|
| PubChem CID | 52945608 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (1R,2S,3E,7E,11S)-1,5,5,8-tetramethyl-12-oxabicyclo[9.1.0]dodeca-3,7-dien-2-ol |
| SMILES | C/C1=C\CC(C)(C)/C=C/[C@H](O)[C@@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C15H24O2/c1-11-5-6-13-15(4,17-13)12(16)8-10-14(2,3)9-7-11/h7-8,10,12-13,16H,5-6,9H2,1-4H3/b10-8+,11-7+/t12-,13-,15+/m0/s1 |
| InChIKey | AXNPQOVZRSRGEF-MABPIYMQSA-N |
| XLogP | 3.22 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|