C17H16N2O — CID 52945666
3-[(1E,3E)-hexa-1,3-dienoxy]-9H-pyrido[3,4-b]indole (PubChem CID 52945666) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-[(1E,3E)-hexa-1,3-dienoxy]-9H-pyrido[3,4-b]indole.
| Compound Name | 3-[(1E,3E)-hexa-1,3-dienoxy]-9H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 52945666 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-[(1E,3E)-hexa-1,3-dienoxy]-9H-pyrido[3,4-b]indole |
| SMILES | CC/C=C/C=C/Oc1cc2c(cn1)[nH]c1ccccc12 |
| InChI | InChI=1S/C17H16N2O/c1-2-3-4-7-10-20-17-11-14-13-8-5-6-9-15(13)19-16(14)12-18-17/h3-12,19H,2H2,1H3/b4-3+,10-7+ |
| InChIKey | PUUXLLSHSWLAML-YZQQHVNFSA-N |
| XLogP | 4.57 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|