About methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate
methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate (PubChem CID 52945667) has the molecular formula C36H30N2O4
and a molecular weight of 554.65 g/mol. Its IUPAC name is methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate |
| PubChem CID | 52945667 |
| Molecular Formula | C36H30N2O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(C(c3c(C)n(C)c4ccccc34)c3c(C)n(C)c4ccccc34)c3ccccc3c2oc1=O |
| InChI | InChI=1S/C36H30N2O4/c1-20-31(25-14-8-10-16-29(25)37(20)3)33(32-21(2)38(4)30-17-11-9-15-26(30)32)27-18-22-19-28(35(39)41-5)36(40)42-34(22)24-13-7-6-12-23(24)27/h6-19,33H,1-5H3 |
| InChIKey | WBTBCSZRRILPDT-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 66.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate?
The IUPAC name of methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate (CID 52945667) is methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate.
What is the SMILES notation for methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate?
The canonical SMILES for methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate is COC(=O)c1cc2cc(C(c3c(C)n(C)c4ccccc34)c3c(C)n(C)c4ccccc34)c3ccccc3c2oc1=O.
What is the InChIKey of methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate?
The InChIKey is WBTBCSZRRILPDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30N2O4/c1-20-31(25-14-8-10-16-29(25)37(20)3)33(32-21(2)38(4)30-17-11-9-15-26(30)32)27-18-22-19-28(35(39)41-5)36(40)42-34(22)24-13-7-6-12-23(24)27/h6-19,33H,1-5H3.
What are the key properties of methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate?
methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate has a molecular weight of 554.65 g/mol, XLogP of 7.51, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[bis(1,2-dimethylindol-3-yl)methyl]-2-oxobenzo[h]chromene-3-carboxylate is sourced from PubChem (CID 52945667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).