About N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide
N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide (PubChem CID 52945700) has the molecular formula C18H18N4
and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide |
| PubChem CID | 52945700 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide |
| SMILES | C/N=C(\C)Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C18H18N4/c1-14(19-2)20-18-13-17(15-9-5-3-6-10-15)21-22(18)16-11-7-4-8-12-16/h3-13H,1-2H3,(H,19,20) |
| InChIKey | XBDQNPNDADJTQC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide?
The IUPAC name of N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide (CID 52945700) is N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide.
What is the SMILES notation for N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide?
The canonical SMILES for N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide is C/N=C(\C)Nc1cc(-c2ccccc2)nn1-c1ccccc1.
What is the InChIKey of N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide?
The InChIKey is XBDQNPNDADJTQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4/c1-14(19-2)20-18-13-17(15-9-5-3-6-10-15)21-22(18)16-11-7-4-8-12-16/h3-13H,1-2H3,(H,19,20).
What are the key properties of N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide?
N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide has a molecular weight of 290.37 g/mol, XLogP of 4.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-diphenylpyrazol-5-yl)-N'-methylethanimidamide is sourced from PubChem (CID 52945700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).