C19H29FN2O4 — CID 52945702
(2S,4R)-4-(4-fluorophenyl)-N-hydroxy-2-[2-[3-(hydroxymethyl)piperidin-1-yl]ethyl]-4-methoxybutanamide (PubChem CID 52945702) has the molecular formula C19H29FN2O4 and a molecular weight of 368.45 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-2-[2-[3-(hydroxymethyl)piperidin-1-yl]ethyl]-4-methoxybutanamide.
| Compound Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-2-[2-[3-(hydroxymethyl)piperidin-1-yl]ethyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 52945702 |
| Molecular Formula | C19H29FN2O4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-2-[2-[3-(hydroxymethyl)piperidin-1-yl]ethyl]-4-methoxybutanamide |
| SMILES | CO[C@H](C[C@H](CCN1CCCC(CO)C1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H29FN2O4/c1-26-18(15-4-6-17(20)7-5-15)11-16(19(24)21-25)8-10-22-9-2-3-14(12-22)13-23/h4-7,14,16,18,23,25H,2-3,8-13H2,1H3,(H,21,24)/t14?,16-,18+/m0/s1 |
| InChIKey | NGWBJDOGQSUINS-RNYWFIABSA-N |
| XLogP | 2.12 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|