C22H23ClN4O — CID 52945732
N-(4-chloro-3-pyridin-2-ylphenyl)-2-methyl-6-(2-methylpropylamino)pyridine-3-carboxamide (PubChem CID 52945732) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-2-methyl-6-(2-methylpropylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-2-methyl-6-(2-methylpropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 52945732 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-2-methyl-6-(2-methylpropylamino)pyridine-3-carboxamide |
| SMILES | Cc1nc(NCC(C)C)ccc1C(=O)Nc1ccc(Cl)c(-c2ccccn2)c1 |
| InChI | InChI=1S/C22H23ClN4O/c1-14(2)13-25-21-10-8-17(15(3)26-21)22(28)27-16-7-9-19(23)18(12-16)20-6-4-5-11-24-20/h4-12,14H,13H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | IXUTTXTUDBKNMJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |