C31H27N3O4 — CID 52945798
methyl (1R,3R)-1-(4-ethylphenyl)-2-[2-(1H-indol-3-yl)-2-oxoacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 52945798) has the molecular formula C31H27N3O4 and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl (1R,3R)-1-(4-ethylphenyl)-2-[2-(1H-indol-3-yl)-2-oxoacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3R)-1-(4-ethylphenyl)-2-[2-(1H-indol-3-yl)-2-oxoacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 52945798 |
| Molecular Formula | C31H27N3O4 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | methyl (1R,3R)-1-(4-ethylphenyl)-2-[2-(1H-indol-3-yl)-2-oxoacetyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@H](C(=O)OC)N2C(=O)C(=O)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H27N3O4/c1-3-18-12-14-19(15-13-18)28-27-22(20-8-5-7-11-25(20)33-27)16-26(31(37)38-2)34(28)30(36)29(35)23-17-32-24-10-6-4-9-21(23)24/h4-15,17,26,28,32-33H,3,16H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | OURKBUZOMILCOI-IXCJQBJRSA-N |
| XLogP | 5.11 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|