About tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate
tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 52945829) has the molecular formula C20H18N2O2S
and a molecular weight of 350.44 g/mol. Its IUPAC name is tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 52945829 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc2c(cn1)[nH]c1ccc(-c3cccs3)cc12 |
| InChI | InChI=1S/C20H18N2O2S/c1-20(2,3)24-19(23)16-10-14-13-9-12(18-5-4-8-25-18)6-7-15(13)22-17(14)11-21-16/h4-11,22H,1-3H3 |
| InChIKey | XIBAUTSZDOVNEE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate (CID 52945829) is tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate is CC(C)(C)OC(=O)c1cc2c(cn1)[nH]c1ccc(-c3cccs3)cc12.
What is the InChIKey of tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is XIBAUTSZDOVNEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2S/c1-20(2,3)24-19(23)16-10-14-13-9-12(18-5-4-8-25-18)6-7-15(13)22-17(14)11-21-16/h4-11,22H,1-3H3.
What are the key properties of tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate?
tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 350.44 g/mol, XLogP of 5.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-thiophen-2-yl-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 52945829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).