About potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate
potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate (PubChem CID 52945850) has the molecular formula C22H17ClKN3OS
and a molecular weight of 446.02 g/mol. Its IUPAC name is potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate.
Molecular Properties
| Compound Name | potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate |
| PubChem CID | 52945850 |
| Molecular Formula | C22H17ClKN3OS |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate |
| SMILES | [K+].[S-]c1nnc(COc2ccc(Cl)cc2)n1Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3OS.K/c23-18-10-12-19(13-11-18)27-15-21-24-25-22(28)26(21)14-17-8-4-5-9-20(17)16-6-2-1-3-7-16;/h1-13H,14-15H2,(H,25,28);/q;+1/p-1 |
| InChIKey | JCABQXKIXHUBPR-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate?
The IUPAC name of potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate (CID 52945850) is potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate.
What is the SMILES notation for potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate?
The canonical SMILES for potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate is [K+].[S-]c1nnc(COc2ccc(Cl)cc2)n1Cc1ccccc1-c1ccccc1.
What is the InChIKey of potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate?
The InChIKey is JCABQXKIXHUBPR-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H18ClN3OS.K/c23-18-10-12-19(13-11-18)27-15-21-24-25-22(28)26(21)14-17-8-4-5-9-20(17)16-6-2-1-3-7-16;/h1-13H,14-15H2,(H,25,28);/q;+1/p-1.
What are the key properties of potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate?
potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate has a molecular weight of 446.02 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 5-[(4-chlorophenoxy)methyl]-4-[(2-phenylphenyl)methyl]-1,2,4-triazole-3-thiolate is sourced from PubChem (CID 52945850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).