C23H24N4O2 — CID 52945855
6-[(3aR,6aS)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyridine-3-carboxamide (PubChem CID 52945855) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-[(3aR,6aS)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-[(3aR,6aS)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 52945855 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 6-[(3aR,6aS)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyridine-3-carboxamide |
| SMILES | O=C(NO)c1ccc(N2C[C@H]3CN(Cc4ccc5ccccc5c4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C23H24N4O2/c28-23(25-29)19-7-8-22(24-10-19)27-14-20-12-26(13-21(20)15-27)11-16-5-6-17-3-1-2-4-18(17)9-16/h1-10,20-21,29H,11-15H2,(H,25,28)/t20-,21+ |
| InChIKey | DANQOBBFZRKLFG-OYRHEFFESA-N |
| XLogP | 2.92 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|