C22H27F4N3O2 — CID 52945891
(2R)-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxy-6-[[4-(trifluoromethyl)phenyl]methylamino]hexanamide (PubChem CID 52945891) has the molecular formula C22H27F4N3O2 and a molecular weight of 441.47 g/mol. Its IUPAC name is (2R)-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxy-6-[[4-(trifluoromethyl)phenyl]methylamino]hexanamide.
| Compound Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxy-6-[[4-(trifluoromethyl)phenyl]methylamino]hexanamide |
|---|---|
| PubChem CID | 52945891 |
| Molecular Formula | C22H27F4N3O2 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | (2R)-2-(4-fluoro-3,5-dimethylanilino)-N-hydroxy-6-[[4-(trifluoromethyl)phenyl]methylamino]hexanamide |
| SMILES | Cc1cc(N[C@H](CCCCNCc2ccc(C(F)(F)F)cc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C22H27F4N3O2/c1-14-11-18(12-15(2)20(14)23)28-19(21(30)29-31)5-3-4-10-27-13-16-6-8-17(9-7-16)22(24,25)26/h6-9,11-12,19,27-28,31H,3-5,10,13H2,1-2H3,(H,29,30)/t19-/m1/s1 |
| InChIKey | BTIWHGODFARUMB-LJQANCHMSA-N |
| XLogP | 4.71 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|