C27H34F7N3O — CID 52945987
[4-fluoro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]-[3-(1,1,2,3,3,3-hexafluoropropyl)-1-adamantyl]methanone (PubChem CID 52945987) has the molecular formula C27H34F7N3O and a molecular weight of 549.58 g/mol. Its IUPAC name is [4-fluoro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]-[3-(1,1,2,3,3,3-hexafluoropropyl)-1-adamantyl]methanone.
| Compound Name | [4-fluoro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]-[3-(1,1,2,3,3,3-hexafluoropropyl)-1-adamantyl]methanone |
|---|---|
| PubChem CID | 52945987 |
| Molecular Formula | C27H34F7N3O |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | [4-fluoro-4-[[(5-methyl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]-[3-(1,1,2,3,3,3-hexafluoropropyl)-1-adamantyl]methanone |
| SMILES | Cc1ccc(CNCC2(F)CCN(C(=O)C34CC5CC(C3)CC(C(F)(F)C(F)C(F)(F)F)(C5)C4)CC2)nc1 |
| InChI | InChI=1S/C27H34F7N3O/c1-17-2-3-20(36-13-17)14-35-16-25(29)4-6-37(7-5-25)22(38)23-9-18-8-19(10-23)12-24(11-18,15-23)26(30,31)21(28)27(32,33)34/h2-3,13,18-19,21,35H,4-12,14-16H2,1H3 |
| InChIKey | KLRNAVFHYDLHNI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |