C24H34ClN3O2 — CID 52946094
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride (PubChem CID 52946094) has the molecular formula C24H34ClN3O2 and a molecular weight of 432.01 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 52946094 |
| Molecular Formula | C24H34ClN3O2 |
| Molecular Weight | 432.01 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[1-(cyclohexylmethyl)-7-methoxyindol-3-yl]methanone;hydrochloride |
| SMILES | COc1cccc2c(C(=O)N3CCN4CCC[C@H]4C3)cn(CC3CCCCC3)c12.Cl |
| InChI | InChI=1S/C24H33N3O2.ClH/c1-29-22-11-5-10-20-21(17-27(23(20)22)15-18-7-3-2-4-8-18)24(28)26-14-13-25-12-6-9-19(25)16-26;/h5,10-11,17-19H,2-4,6-9,12-16H2,1H3;1H/t19-;/m0./s1 |
| InChIKey | MIILUVBXPPKGDE-FYZYNONXSA-N |
| XLogP | 4.57 |
| TPSA | 37.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.01 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |