About 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole
4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole (PubChem CID 52946282) has the molecular formula C23H26N2S2
and a molecular weight of 394.61 g/mol. Its IUPAC name is 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole |
| PubChem CID | 52946282 |
| Molecular Formula | C23H26N2S2 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole |
| SMILES | c1ccc(-c2nc(SCCCN3CCCCC3)sc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2S2/c1-4-11-19(12-5-1)21-22(20-13-6-2-7-14-20)27-23(24-21)26-18-10-17-25-15-8-3-9-16-25/h1-2,4-7,11-14H,3,8-10,15-18H2 |
| InChIKey | WTQZWJPQDXFSHK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole?
The IUPAC name of 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole (CID 52946282) is 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole.
What is the SMILES notation for 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole?
The canonical SMILES for 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole is c1ccc(-c2nc(SCCCN3CCCCC3)sc2-c2ccccc2)cc1.
What is the InChIKey of 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole?
The InChIKey is WTQZWJPQDXFSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2S2/c1-4-11-19(12-5-1)21-22(20-13-6-2-7-14-20)27-23(24-21)26-18-10-17-25-15-8-3-9-16-25/h1-2,4-7,11-14H,3,8-10,15-18H2.
What are the key properties of 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole?
4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole has a molecular weight of 394.61 g/mol, XLogP of 6.45, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-2-(3-piperidin-1-ylpropylsulfanyl)-1,3-thiazole is sourced from PubChem (CID 52946282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).