About 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one
6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (PubChem CID 52946313) has the molecular formula C18H10Cl2FN3O
and a molecular weight of 374.20 g/mol. Its IUPAC name is 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
Molecular Properties
| Compound Name | 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| PubChem CID | 52946313 |
| Molecular Formula | C18H10Cl2FN3O |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one |
| SMILES | O=c1[nH]ccc2nc(Nc3c(Cl)cccc3Cl)c3ccc(F)cc3c12 |
| InChI | InChI=1S/C18H10Cl2FN3O/c19-12-2-1-3-13(20)16(12)24-17-10-5-4-9(21)8-11(10)15-14(23-17)6-7-22-18(15)25/h1-8H,(H,22,25)(H,23,24) |
| InChIKey | ZGBZDEDHSMWXEG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one?
The IUPAC name of 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one (CID 52946313) is 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one.
What is the SMILES notation for 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one?
The canonical SMILES for 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one is O=c1[nH]ccc2nc(Nc3c(Cl)cccc3Cl)c3ccc(F)cc3c12.
What is the InChIKey of 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one?
The InChIKey is ZGBZDEDHSMWXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10Cl2FN3O/c19-12-2-1-3-13(20)16(12)24-17-10-5-4-9(21)8-11(10)15-14(23-17)6-7-22-18(15)25/h1-8H,(H,22,25)(H,23,24).
What are the key properties of 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one?
6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one has a molecular weight of 374.20 g/mol, XLogP of 5.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,6-dichloroanilino)-9-fluoro-2H-benzo[c][1,6]naphthyridin-1-one is sourced from PubChem (CID 52946313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).