C29H37NO3 — CID 52946388
(1R,4aS,9E,10aR)-1,4a-dimethyl-9-(3-phenylpropoxyimino)-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 52946388) has the molecular formula C29H37NO3 and a molecular weight of 447.62 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-1,4a-dimethyl-9-(3-phenylpropoxyimino)-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-1,4a-dimethyl-9-(3-phenylpropoxyimino)-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 52946388 |
| Molecular Formula | C29H37NO3 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (1R,4aS,9E,10aR)-1,4a-dimethyl-9-(3-phenylpropoxyimino)-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1ccc2c(c1)/C(=N/OCCCc1ccccc1)C[C@H]1[C@](C)(C(=O)O)CCC[C@]21C |
| InChI | InChI=1S/C29H37NO3/c1-20(2)22-13-14-24-23(18-22)25(30-33-17-8-12-21-10-6-5-7-11-21)19-26-28(24,3)15-9-16-29(26,4)27(31)32/h5-7,10-11,13-14,18,20,26H,8-9,12,15-17,19H2,1-4H3,(H,31,32)/b30-25+/t26-,28-,29-/m1/s1 |
| InChIKey | QFODQIQYFHUBMX-KCSBEDLWSA-N |
| XLogP | 6.72 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|