About 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol
1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol (PubChem CID 52946537) has the molecular formula C20H24N4O2S
and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol |
| PubChem CID | 52946537 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol |
| SMILES | OC(CNC1CCN(c2ncnc3ccsc23)CC1)COc1ccccc1 |
| InChI | InChI=1S/C20H24N4O2S/c25-16(13-26-17-4-2-1-3-5-17)12-21-15-6-9-24(10-7-15)20-19-18(8-11-27-19)22-14-23-20/h1-5,8,11,14-16,21,25H,6-7,9-10,12-13H2 |
| InChIKey | LKDUKYSSAMAXEU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol?
The IUPAC name of 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol (CID 52946537) is 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol.
What is the SMILES notation for 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol?
The canonical SMILES for 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol is OC(CNC1CCN(c2ncnc3ccsc23)CC1)COc1ccccc1.
What is the InChIKey of 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol?
The InChIKey is LKDUKYSSAMAXEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O2S/c25-16(13-26-17-4-2-1-3-5-17)12-21-15-6-9-24(10-7-15)20-19-18(8-11-27-19)22-14-23-20/h1-5,8,11,14-16,21,25H,6-7,9-10,12-13H2.
What are the key properties of 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol?
1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol has a molecular weight of 384.51 g/mol, XLogP of 2.69, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxy-3-[(1-thieno[3,2-d]pyrimidin-4-ylpiperidin-4-yl)amino]propan-2-ol is sourced from PubChem (CID 52946537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).