About N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide
N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide (PubChem CID 529467) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide |
| PubChem CID | 529467 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide |
| SMILES | CC(NC(=O)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C10H16F3NO/c1-7(8-5-3-2-4-6-8)14-9(15)10(11,12)13/h7-8H,2-6H2,1H3,(H,14,15) |
| InChIKey | OGMDDSGBDBOSPC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide (CID 529467) is N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide is CC(NC(=O)C(F)(F)F)C1CCCCC1.
What is the InChIKey of N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide?
The InChIKey is OGMDDSGBDBOSPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO/c1-7(8-5-3-2-4-6-8)14-9(15)10(11,12)13/h7-8H,2-6H2,1H3,(H,14,15).
What are the key properties of N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide?
N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide has a molecular weight of 223.24 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclohexylethyl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 529467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).