C30H31F2N5O2 — CID 52946705
N-[(1S)-3-[(1R,5S)-3-(5-fluoro-2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-(3-fluorophenyl)propyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 52946705) has the molecular formula C30H31F2N5O2 and a molecular weight of 531.61 g/mol. Its IUPAC name is N-[(1S)-3-[(1R,5S)-3-(5-fluoro-2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-(3-fluorophenyl)propyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[(1S)-3-[(1R,5S)-3-(5-fluoro-2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-(3-fluorophenyl)propyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 52946705 |
| Molecular Formula | C30H31F2N5O2 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | N-[(1S)-3-[(1R,5S)-3-(5-fluoro-2-methylbenzimidazol-1-yl)-8-azabicyclo[3.2.1]octan-8-yl]-1-(3-fluorophenyl)propyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | Cc1nc2cc(F)ccc2n1C1C[C@H]2CC[C@@H](C1)N2CC[C@H](NC(=O)c1cc[n+]([O-])cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C30H31F2N5O2/c1-19-33-28-16-23(32)5-8-29(28)37(19)26-17-24-6-7-25(18-26)36(24)14-11-27(21-3-2-4-22(31)15-21)34-30(38)20-9-12-35(39)13-10-20/h2-5,8-10,12-13,15-16,24-27H,6-7,11,14,17-18H2,1H3,(H,34,38)/t24-,25+,26?,27-/m0/s1 |
| InChIKey | VJCWDBQSPPXKCG-UEEAVMEZSA-N |
| XLogP | 4.99 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|