C23H25F3N8O3 — CID 52946706
1-methyl-8-[5-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide (PubChem CID 52946706) has the molecular formula C23H25F3N8O3 and a molecular weight of 518.50 g/mol. Its IUPAC name is 1-methyl-8-[5-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide.
| Compound Name | 1-methyl-8-[5-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
|---|---|
| PubChem CID | 52946706 |
| Molecular Formula | C23H25F3N8O3 |
| Molecular Weight | 518.50 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 1-methyl-8-[5-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-2-(trifluoromethoxy)anilino]-4,5-dihydropyrazolo[4,5-h]quinazoline-3-carboxamide |
| SMILES | Cn1nc(C(N)=O)c2c1-c1nc(Nc3cc(N4CC[N+](C)([O-])CC4)ccc3OC(F)(F)F)ncc1CC2 |
| InChI | InChI=1S/C23H25F3N8O3/c1-32-20-15(19(31-32)21(27)35)5-3-13-12-28-22(30-18(13)20)29-16-11-14(4-6-17(16)37-23(24,25)26)33-7-9-34(2,36)10-8-33/h4,6,11-12H,3,5,7-10H2,1-2H3,(H2,27,35)(H,28,29,30) |
| InChIKey | WDYNAWBNNIUDEQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|