C11H22ClN3O4S — CID 52946729
(5R,6R,7S,8R,8aS)-3-(4-aminobutylimino)-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridine-5,6,7,8-tetrol;hydrochloride (PubChem CID 52946729) has the molecular formula C11H22ClN3O4S and a molecular weight of 327.83 g/mol. Its IUPAC name is (5R,6R,7S,8R,8aS)-3-(4-aminobutylimino)-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridine-5,6,7,8-tetrol;hydrochloride.
| Compound Name | (5R,6R,7S,8R,8aS)-3-(4-aminobutylimino)-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridine-5,6,7,8-tetrol;hydrochloride |
|---|---|
| PubChem CID | 52946729 |
| Molecular Formula | C11H22ClN3O4S |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (5R,6R,7S,8R,8aS)-3-(4-aminobutylimino)-1,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,4-a]pyridine-5,6,7,8-tetrol;hydrochloride |
| SMILES | Cl.NCCCC/N=C1\SC[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)N12 |
| InChI | InChI=1S/C11H21N3O4S.ClH/c12-3-1-2-4-13-11-14-6(5-19-11)7(15)8(16)9(17)10(14)18;/h6-10,15-18H,1-5,12H2;1H/b13-11-;/t6-,7-,8+,9-,10-;/m1./s1 |
| InChIKey | NDUYKOIRAHYBRH-HVQZKUGOSA-N |
| XLogP | -1.66 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|