About 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one
5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one (PubChem CID 52946835) has the molecular formula C27H31N3O2
and a molecular weight of 429.56 g/mol. Its IUPAC name is 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one |
| PubChem CID | 52946835 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one |
| SMILES | Cc1cc2c(cc1OCCCCN1CCN(c3cccc4ccccc34)CC1)C(=O)NC2 |
| InChI | InChI=1S/C27H31N3O2/c1-20-17-22-19-28-27(31)24(22)18-26(20)32-16-5-4-11-29-12-14-30(15-13-29)25-10-6-8-21-7-2-3-9-23(21)25/h2-3,6-10,17-18H,4-5,11-16,19H2,1H3,(H,28,31) |
| InChIKey | VPAUPKOMHDFAMG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one (CID 52946835) is 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one is Cc1cc2c(cc1OCCCCN1CCN(c3cccc4ccccc34)CC1)C(=O)NC2.
What is the InChIKey of 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one?
The InChIKey is VPAUPKOMHDFAMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31N3O2/c1-20-17-22-19-28-27(31)24(22)18-26(20)32-16-5-4-11-29-12-14-30(15-13-29)25-10-6-8-21-7-2-3-9-23(21)25/h2-3,6-10,17-18H,4-5,11-16,19H2,1H3,(H,28,31).
What are the key properties of 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one?
5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one has a molecular weight of 429.56 g/mol, XLogP of 4.37, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-6-[4-(4-naphthalen-1-ylpiperazin-1-yl)butoxy]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 52946835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).