About 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid
3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid (PubChem CID 5294686) has the molecular formula C27H29NO4
and a molecular weight of 431.53 g/mol. Its IUPAC name is 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid |
| PubChem CID | 5294686 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid |
| SMILES | CCCOc1ccc(C(CC(=O)O)NC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29NO4/c1-2-17-32-23-15-13-22(14-16-23)25(19-27(30)31)28-26(29)18-24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,24-25H,2,17-19H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | SOGHSWDMXSQIFG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid?
The IUPAC name of 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid (CID 5294686) is 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid.
What is the SMILES notation for 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid?
The canonical SMILES for 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid is CCCOc1ccc(C(CC(=O)O)NC(=O)CC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid?
The InChIKey is SOGHSWDMXSQIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29NO4/c1-2-17-32-23-15-13-22(14-16-23)25(19-27(30)31)28-26(29)18-24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,24-25H,2,17-19H2,1H3,(H,28,29)(H,30,31).
What are the key properties of 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid?
3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid has a molecular weight of 431.53 g/mol, XLogP of 5.33, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-diphenylpropanoylamino)-3-(4-propoxyphenyl)propanoic acid is sourced from PubChem (CID 5294686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).